1-(2-methoxyphenyl)-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine structure
|
Common Name | 1-(2-methoxyphenyl)-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 144649-74-1 | Molecular Weight | 348.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-methoxyphenyl)-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine |
|---|
| Molecular Formula | C21H24N4O |
|---|---|
| Molecular Weight | 348.44100 |
| Exact Mass | 348.19500 |
| PSA | 44.39000 |
| LogP | 3.41040 |
| InChIKey | DVOGAODGHIXYRO-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCN(Cc2cnc(-c3ccccc3)[nH]2)CC1 |
|
~%
1-(2-methoxyphe... CAS#:144649-74-1 |
| Literature: Neurogen Corporation, Corporation of the State of Delaware Patent: US2003/18025 A1, 2003 ; US 20030018025 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |