tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate
Modify Date: 2026-07-18 22:51:14
tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate structure
|
Common Name | tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1446512-80-6 | Molecular Weight | 277.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO4 |
|---|---|
| Molecular Weight | 277.31 |
| InChIKey | OHUUMZGYRSYMPB-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)OC(C)(C)C)[nH]c2cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: The English name of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate. |
| Q: What is the CAS number of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: CAS number of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is 1446512-80-6. |
| Q: What is the molecular weight of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Molecular weight of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is 277.31. |
| Q: What is the molecular formula of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Molecular formula of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is C15H19NO4. |
| Q: What is the InChIKey of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: InChIKey of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is OHUUMZGYRSYMPB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: SMILES notation of tert-Butyl 5,6-dimethoxy-1H-indole-2-carboxylate is COc1cc2cc(C(=O)OC(C)(C)C)[nH]c2cc1OC. |
| Q: What is the Chinese name of 1446512-80-6? |
| A: Chinese name of 1446512-80-6 is 1446512-80-6. |