cyclophostin structure
|
Common Name | cyclophostin | ||
|---|---|---|---|---|
| CAS Number | 144773-26-2 | Molecular Weight | 234.14300 | |
| Density | 1.41g/cm3 | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C8H11O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
Use of cyclophostinCyclophostin is an acetylcholinesterase (AChE) inhibitor with IC50 values of 45, 0.76 and 1.3 nM for humans and two different insects, respectively[1]. |
| Name | (3R,8aR)-3-methoxy-5-methyl-3-oxo-8,8a-dihydro-1H-furo[3,4-e][1,3,2]dioxaphosphepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclophostin is an acetylcholinesterase (AChE) inhibitor with IC50 values of 45, 0.76 and 1.3 nM for humans and two different insects, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760mmHg |
| Molecular Formula | C8H11O6P |
| Molecular Weight | 234.14300 |
| Flash Point | 172ºC |
| Exact Mass | 234.02900 |
| PSA | 80.87000 |
| LogP | 1.23470 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | OMPQJMDGDAAXPE-NPMWZIQKSA-N |
| SMILES | COP1(=O)OCC2COC(=O)C2=C(C)O1 |
| Cyclophostin |
| Rac-Cyclophostin |
| 1H,6H-Furo(3,4-e)(1,3,2)dioxaphosphepin-6-one,8,8a-dihydro-3-methoxy-5-methyl-,3-oxide,(3R-cis) |