2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine
Modify Date: 2025-10-14 16:12:49
2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine structure
|
Common Name | 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine | ||
|---|---|---|---|---|
| CAS Number | 1448065-80-2 | Molecular Weight | 431.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16BrClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16BrClN2O3S |
|---|---|
| Molecular Weight | 431.7 |
| InChIKey | FOOCRPSCPZRLDZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCC(Oc2ncccc2Cl)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: Molecular formula of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is C16H16BrClN2O3S. |
| Q: What is the molecular weight of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: Molecular weight of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is 431.7. |
| Q: What is the CAS number of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: CAS number of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is 1448065-80-2. |
| Q: What is the Chinese name of 1448065-80-2? |
| A: Chinese name of 1448065-80-2 is 1448065-80-2. |
| Q: What is the SMILES notation of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: SMILES notation of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is O=S(=O)(c1ccc(Br)cc1)N1CCC(Oc2ncccc2Cl)CC1. |
| Q: What is the InChIKey of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: InChIKey of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is FOOCRPSCPZRLDZ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine? |
| A: The English name of 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine is 2-((1-((4-Bromophenyl)sulfonyl)piperidin-4-yl)oxy)-3-chloropyridine. |