2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate
Modify Date: 2026-07-18 17:22:21
2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate structure
|
Common Name | 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 144809-26-7 | Molecular Weight | 229.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO3S |
|---|---|
| Molecular Weight | 229.30 |
| InChIKey | QBBOABZXKOJOEC-UHFFFAOYSA-N |
| SMILES | CCc1ccc(CCOS(C)(=O)=O)nc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: The English name of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate. |
| Q: What is the molecular weight of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: Molecular weight of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is 229.30. |
| Q: What is the InChIKey of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: InChIKey of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is QBBOABZXKOJOEC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: SMILES notation of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is CCc1ccc(CCOS(C)(=O)=O)nc1. |
| Q: What is the Chinese name of 144809-26-7? |
| A: Chinese name of 144809-26-7 is 144809-26-7. |
| Q: What is the CAS number of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: CAS number of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is 144809-26-7. |
| Q: What is the molecular formula of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate? |
| A: Molecular formula of 2-(5-Ethyl-pyridin-2-yl)ethyl methanesulfonate is C10H15NO3S. |