Rifamycin B piperidide structure
|
Common Name | Rifamycin B piperidide | ||
|---|---|---|---|---|
| CAS Number | 14487-04-8 | Molecular Weight | 822.93700 | |
| Density | 1.32g/cm3 | Boiling Point | 958.5ºC at 760 mmHg | |
| Molecular Formula | C44H58N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 533.5ºC | |
| Name | Rifamycin B piperidide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 958.5ºC at 760 mmHg |
| Molecular Formula | C44H58N2O13 |
| Molecular Weight | 822.93700 |
| Flash Point | 533.5ºC |
| Exact Mass | 822.39400 |
| PSA | 214.11000 |
| LogP | 5.46280 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | IRRNPBXDKFHKSC-BFKGEMDOSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(cc(OCC(=O)N5CCCCC5)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
Rifamycin B pip... CAS#:14487-04-8 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Rifamycin-B-piperidid |
| rifamycin-B piperidide |