4,5-Dihydro-5-((4-(4-(dimethylamino)phenyl)-1-piperazinyl)methyl)-2-ox azolamine structure
|
Common Name | 4,5-Dihydro-5-((4-(4-(dimethylamino)phenyl)-1-piperazinyl)methyl)-2-ox azolamine | ||
|---|---|---|---|---|
| CAS Number | 144881-38-9 | Molecular Weight | 303.40300 | |
| Density | 1.24g/cm3 | Boiling Point | 485.2ºC at 760mmHg | |
| Molecular Formula | C16H25N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 5-[[4-[4-(dimethylamino)phenyl]piperazin-1-yl]methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 485.2ºC at 760mmHg |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.40300 |
| Flash Point | 247.2ºC |
| Exact Mass | 303.20600 |
| PSA | 54.83000 |
| LogP | 1.22920 |
| Vapour Pressure | 1.44E-09mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | PAGGCFCCWFPUFN-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N2CCN(CC3CN=C(N)O3)CC2)cc1 |
|
~%
4,5-Dihydro-5-(... CAS#:144881-38-9 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |