4-[(4-cyanobenzoyl)amino]phthalic acid
![4-[(4-cyanobenzoyl)amino]phthalic acid Structure](https://image.chemsrc.com/caspic/331/144907-46-0.png)
4-[(4-cyanobenzoyl)amino]phthalic acid structure
|
Common Name | 4-[(4-cyanobenzoyl)amino]phthalic acid | ||
|---|---|---|---|---|
| CAS Number | 144907-46-0 | Molecular Weight | 310.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(4-cyanobenzoyl)amino]phthalic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H10N2O5 |
|---|---|
| Molecular Weight | 310.26100 |
| Exact Mass | 310.05900 |
| PSA | 127.49000 |
| LogP | 2.27998 |
| InChIKey | FGCVPJXSXRZYPA-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(C(=O)O)c(C(=O)O)c2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:5434-21-9
CAS#:6068-72-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiallergic activity against rat passive cutaneous anaphylaxis (PCA) reaction induce...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL781420
|
|
Name: Cytoprotective activity against ethanol-induced gastric lesions in male conscious rat...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL788009
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: The English name of 4-[(4-cyanobenzoyl)amino]phthalic acid is 4-[(4-cyanobenzoyl)amino]phthalic acid. |
| Q: What is the LogP of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: LogP of 4-[(4-cyanobenzoyl)amino]phthalic acid is 2.27998. |
| Q: What is the SMILES notation of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: SMILES notation of 4-[(4-cyanobenzoyl)amino]phthalic acid is N#Cc1ccc(C(=O)Nc2ccc(C(=O)O)c(C(=O)O)c2)cc1. |
| Q: What is the polar surface area (PSA) of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: Polar surface area (PSA) of 4-[(4-cyanobenzoyl)amino]phthalic acid is 127.49000. |
| Q: What is the Chinese name of 144907-46-0? |
| A: Chinese name of 144907-46-0 is 144907-46-0. |
| Q: What is the molecular formula of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: Molecular formula of 4-[(4-cyanobenzoyl)amino]phthalic acid is C16H10N2O5. |
| Q: What are the upstream materials of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: Related upstream materials(CAS) of 4-[(4-cyanobenzoyl)amino]phthalic acid: 5434-21-9;6068-72-0. |
| Q: What is the InChIKey of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: InChIKey of 4-[(4-cyanobenzoyl)amino]phthalic acid is FGCVPJXSXRZYPA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: CAS number of 4-[(4-cyanobenzoyl)amino]phthalic acid is 144907-46-0. |
| Q: What is the molecular weight of 4-[(4-cyanobenzoyl)amino]phthalic acid? |
| A: Molecular weight of 4-[(4-cyanobenzoyl)amino]phthalic acid is 310.26100. |