N-[(3-Chlorophenyl)sulfonyl]phenylalanine structure
|
Common Name | N-[(3-Chlorophenyl)sulfonyl]phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 1449132-27-7 | Molecular Weight | 339.794 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 541.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H14ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5±32.9 °C | |
Use of N-[(3-Chlorophenyl)sulfonyl]phenylalanine((3-Chlorophenyl)sulfonyl)phenylalanine is a phenylalanine analogue, contains both an amino group and a carboxyl group in its molecule. |
| Name | N-[(3-Chlorophenyl)sulfonyl]phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | ((3-Chlorophenyl)sulfonyl)phenylalanine is a phenylalanine analogue, contains both an amino group and a carboxyl group in its molecule. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.9±60.0 °C at 760 mmHg |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.794 |
| Flash Point | 281.5±32.9 °C |
| Exact Mass | 339.033203 |
| LogP | 3.78 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | XZBAIPMBXLSRKT-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)NS(=O)(=O)c1cccc(Cl)c1 |
| MFCD07433680 |
| N-[(3-Chlorophenyl)sulfonyl]phenylalanine |
| EINECS 207-439-9 |
| Phenylalanine, N-[(3-chlorophenyl)sulfonyl]- |