1-(4-ETHYL-BENZYL)-PIPERAZINE structure
|
Common Name | 1-(4-ETHYL-BENZYL)-PIPERAZINE | ||
|---|---|---|---|---|
| CAS Number | 144977-47-9 | Molecular Weight | 246.36300 | |
| Density | 0.98 | Boiling Point | 296.7ºC at 760 mmHg | |
| Molecular Formula | C17H23F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.7ºC | |
| Name | 1-fluoro-2-methyl-4-(3,3,5,5-tetramethylcyclohexen-1-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98 |
|---|---|
| Boiling Point | 296.7ºC at 760 mmHg |
| Molecular Formula | C17H23F |
| Molecular Weight | 246.36300 |
| Flash Point | 125.7ºC |
| Exact Mass | 246.17800 |
| LogP | 5.36370 |
| Vapour Pressure | 0.00249mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | DGWOCNOIHNULTH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2=CC(C)(C)CC(C)(C)C2)ccc1F |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Fluoro-3-Methylphenyl)-3,3,5,5-tetraMethylcyclohexene |
| F0377 |