Benzeneethanol,4-methyl-, 1-(4-methylbenzenesulfonate) structure
|
Common Name | Benzeneethanol,4-methyl-, 1-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 14503-40-3 | Molecular Weight | 290.37700 | |
| Density | 1.174g/cm3 | Boiling Point | 441.9ºC at 760mmHg | |
| Molecular Formula | C16H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.1ºC | |
| Name | 4-methylphenethyl tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 441.9ºC at 760mmHg |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.37700 |
| Flash Point | 221.1ºC |
| Exact Mass | 290.09800 |
| PSA | 51.75000 |
| LogP | 4.33220 |
| Vapour Pressure | 1.36E-07mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | DBLJZZQZTIXACJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~53%
Benzeneethanol,... CAS#:14503-40-3 |
| Literature: Mach, Robert H.; Vangveravong, Suwanna; Huang, Yunsheng; Yang, Biao; Blair, Joseph B.; Wu, Li Medicinal Chemistry Research, 2003 , vol. 11, # 7 p. 380 - 398 |
|
~%
Benzeneethanol,... CAS#:14503-40-3 |
| Literature: Schadt,F.L. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 228 - 246 |
|
~%
Benzeneethanol,... CAS#:14503-40-3 |
| Literature: Schadt,F.L. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 228 - 246 |
| 1-<p-Tolyl>-cyclopentanon-(2) |
| 2-(4-methylphenyl)cyclopentanone |
| 2-p-tolylethyl tosylate |
| 2-p-tolylethyl toluene-p-sulphonate |
| Cyclopentanone,2-(4-methylphenyl) |
| p-Toluolsulfonsaeure-(4-methyl-phenethylester) |
| 2-p-tolyl-cyclopentanone |
| 2-p-Tolyl-cyclopentanon |
| (2-p-Tolyl-ethyl)-p-toluolsulfonat |
| 2-(4-methylphenyl)ethyl tosylate |