4-methylbenzenesulfonic acid,(3-methylphenyl)methanol structure
|
Common Name | 4-methylbenzenesulfonic acid,(3-methylphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 14503-41-4 | Molecular Weight | 294.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylbenzenesulfonic acid,(3-methylphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18O4S |
|---|---|
| Molecular Weight | 294.36600 |
| Exact Mass | 294.09300 |
| PSA | 82.98000 |
| LogP | 3.80980 |
| InChIKey | MOCZCGWOHZJUHM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1cccc(CO)c1 |
|
~%
4-methylbenzene... CAS#:14503-41-4 |
| Literature: Streitwieser,A. et al. Journal of the American Chemical Society, 1970 , vol. 92, # 17 p. 5141 - 5150 |
|
~%
4-methylbenzene... CAS#:14503-41-4 |
| Literature: Kochi; Hammond Journal of the American Chemical Society, 1953 , vol. 75, p. 3452,3453 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| m-methylbenzyl tosylate |
| m-Methyl-benzyltosylat |
| Benzenemethanol,3-methyl-,4-methylbenzenesulfonate |
| 3-MeC6H4CH2OTs |