Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)
Modify Date: 2025-09-09 20:02:56
Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) structure
|
Common Name | Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) | ||
|---|---|---|---|---|
| CAS Number | 1451260-75-5 | Molecular Weight | 284.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10BrNOS |
|---|---|
| Molecular Weight | 284.17 |
| InChIKey | JJNGORFPSPBJIC-UHFFFAOYSA-N |
| SMILES | Brc1ccc2nc(C3CCCO3)sc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: CAS number of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is 1451260-75-5. |
| Q: What is the molecular weight of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: Molecular weight of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is 284.17. |
| Q: What is the InChIKey of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: InChIKey of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is JJNGORFPSPBJIC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1451260-75-5? |
| A: Chinese name of 1451260-75-5 is 1451260-75-5. |
| Q: What is the English name of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: The English name of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl). |
| Q: What is the SMILES notation of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: SMILES notation of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is Brc1ccc2nc(C3CCCO3)sc2c1. |
| Q: What is the molecular formula of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl)? |
| A: Molecular formula of Benzothiazole, 6-bromo-2-(tetrahydro-2-furanyl) is C11H10BrNOS. |