[butoxy-(4-tert-butylbenzoyl)amino] acetate
Modify Date: 2025-11-30 21:50:00
![[butoxy-(4-tert-butylbenzoyl)amino] acetate Structure](https://image.chemsrc.com/caspic/121/145142-71-8.png)
[butoxy-(4-tert-butylbenzoyl)amino] acetate structure
|
Common Name | [butoxy-(4-tert-butylbenzoyl)amino] acetate | ||
|---|---|---|---|---|
| CAS Number | 145142-71-8 | Molecular Weight | 307.38500 | |
| Density | 1.069g/cm3 | Boiling Point | 381.4ºC at 760mmHg | |
| Molecular Formula | C17H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [butoxy-(4-tert-butylbenzoyl)amino] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760mmHg |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.38500 |
| Exact Mass | 307.17800 |
| PSA | 55.84000 |
| LogP | 3.63610 |
| Vapour Pressure | 5.1E-06mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | AFQAIJFWMTYTFR-UHFFFAOYSA-N |
| SMILES | CCCCON(OC(C)=O)C(=O)c1ccc(C(C)(C)C)cc1 |
|
~%
[butoxy-(4-tert... CAS#:145142-71-8 |
| Literature: Campbell, John J.; Glover, Stephen A.; Hammond, Gerard P.; Rowbottom, Colleen A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1991 , # 12 p. 2067 - 2080 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| butyl N-acetoxy-p-tert-butylbenzohydroxamate |