Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate
Modify Date: 2026-07-07 14:05:00
![Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate Structure](https://www.chemsrc.com/extcaspic/284/1452829-06-9.png)
Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate structure
|
Common Name | Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate | ||
|---|---|---|---|---|
| CAS Number | 1452829-06-9 | Molecular Weight | 466.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H41NO2SSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H41NO2SSn |
|---|---|
| Molecular Weight | 466.3 |
| InChIKey | HPFKSWZCSAGYMT-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)CSC(C)(C)C(N)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1452829-06-9? |
| A: Chinese name of 1452829-06-9 is 1452829-06-9. |
| Q: What is the CAS number of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: CAS number of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is 1452829-06-9. |
| Q: What is the molecular weight of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: Molecular weight of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is 466.3. |
| Q: What is the English name of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: The English name of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate. |
| Q: What is the SMILES notation of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: SMILES notation of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is CCCC[Sn](CCCC)(CCCC)CSC(C)(C)C(N)C(=O)OC. |
| Q: What is the InChIKey of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: InChIKey of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is HPFKSWZCSAGYMT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate? |
| A: Molecular formula of Methyl 2-amino-3-methyl-3-{[(tributylstannyl)methyl]sulfanyl}butanoate is C19H41NO2SSn. |