2-(ACETYLAMINO)-4,5-DIMETHOXYBENZOIC ACID structure
|
Common Name | 2-(ACETYLAMINO)-4,5-DIMETHOXYBENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 145352-75-6 | Molecular Weight | 239.22500 | |
| Density | 1.306g/cm3 | Boiling Point | 445.8ºC at 760 mmHg | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 2-acetamido-4,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760 mmHg |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22500 |
| Flash Point | 223.4ºC |
| Exact Mass | 239.07900 |
| PSA | 84.86000 |
| LogP | 1.43340 |
| Vapour Pressure | 9.89E-09mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | GFIPYKUNLSFXTQ-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(C)=O)c(C(=O)O)cc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-Acetylamino-4,5-dimethoxy-benzoesaeure |
| 6-Acetamino-3.4-dimethoxy-benzoesaeure |
| 6-Acetamino-veratrumsaeure |