3,3',4-Trihydroxystilbene structure
|
Common Name | 3,3',4-Trihydroxystilbene | ||
|---|---|---|---|---|
| CAS Number | 145356-40-7 | Molecular Weight | 228.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3',4-Trihydroxystilbene |
|---|
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24 |
| InChIKey | QNVSXXGDAPORNA-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=C/C2=CC(=C(C=C2)O)O |
|
Name: Tested in vitro for the inhibition of protein-tyrosine kinase p56lck using angiotensi...
Source: ChEMBL
Target: Tyrosine-protein kinase Lck
External Id: CHEMBL765997
|