2-Acetylphenyl 3-methoxy-4-nitrobenzoate structure
|
Common Name | 2-Acetylphenyl 3-methoxy-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 145370-32-7 | Molecular Weight | 315.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetylphenyl) 3-methoxy-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO6 |
|---|---|
| Molecular Weight | 315.27800 |
| Exact Mass | 315.07400 |
| PSA | 98.42000 |
| LogP | 3.54840 |
| InChIKey | GENZJPOSABKOLJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Oc2ccccc2C(C)=O)ccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| benzoic acid,3-methoxy-4-nitro-,2-acetylphenyl ester |