ethyl 3-methyl-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoate structure
|
Common Name | ethyl 3-methyl-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 145440-92-2 | Molecular Weight | 288.29900 | |
| Density | 1.246g/cm3 | Boiling Point | 386.6ºC at 760mmHg | |
| Molecular Formula | C15H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | ethyl 3-methyl-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoate |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760mmHg |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.29900 |
| Flash Point | 187.6ºC |
| Exact Mass | 288.11100 |
| PSA | 81.43000 |
| LogP | 2.79340 |
| Vapour Pressure | 3.49E-06mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | DKVXYJOFZQHUND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(C)c1NC(=O)c1cc(C)on1 |
|
~%
ethyl 3-methyl-... CAS#:145440-92-2 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
|
~%
ethyl 3-methyl-... CAS#:145440-92-2 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |