N-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide structure
|
Common Name | N-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 145440-97-7 | Molecular Weight | 271.09900 | |
| Density | 1.469g/cm3 | Boiling Point | 331.9ºC at 760mmHg | |
| Molecular Formula | C11H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5ºC | |
| Name | N-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 331.9ºC at 760mmHg |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.09900 |
| Flash Point | 154.5ºC |
| Exact Mass | 269.99600 |
| PSA | 55.13000 |
| LogP | 3.61510 |
| Vapour Pressure | 0.000152mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | VSEACZCDIFRYMJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Nc2c(Cl)cccc2Cl)no1 |
|
~%
N-(2,6-dichloro... CAS#:145440-97-7 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |