(E)-N-(2,6-dimethylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide structure
|
Common Name | (E)-N-(2,6-dimethylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 145441-04-9 | Molecular Weight | 256.30000 | |
| Density | 1.185g/cm3 | Boiling Point | 471.6ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239ºC | |
| Name | (E)-N-(2,6-dimethylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 471.6ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 239ºC |
| Exact Mass | 256.12100 |
| PSA | 58.62000 |
| LogP | 3.90120 |
| Vapour Pressure | 4.59E-09mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | JRKDJBHKCLNIEC-BQYQJAHWSA-N |
| SMILES | Cc1cc(C=CC(=O)Nc2c(C)cccc2C)no1 |
|
~%
(E)-N-(2,6-dime... CAS#:145441-04-9 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
|
~%
(E)-N-(2,6-dime... CAS#:145441-04-9 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |