(2,6-dimethylphenyl) 5-methyl-1,2-oxazole-3-carboxylate structure
|
Common Name | (2,6-dimethylphenyl) 5-methyl-1,2-oxazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 145441-06-1 | Molecular Weight | 231.24700 | |
| Density | 1.169g/cm3 | Boiling Point | 426.4ºC at 760mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | (2,6-dimethylphenyl) 5-methyl-1,2-oxazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 211.7ºC |
| Exact Mass | 231.09000 |
| PSA | 52.33000 |
| LogP | 2.81900 |
| Vapour Pressure | 1.77E-07mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | WGUSIUPNBKYKKP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Oc2c(C)cccc2C)no1 |
|
~%
(2,6-dimethylph... CAS#:145441-06-1 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Isoxazolecarboxylic acid,5-methyl-,2,6-dimethylphenyl ester |
| 2,6-Dimethylphenyl 5-methyl-3-isoxazolecarboxylate |