2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one
Modify Date: 2025-09-23 15:29:57
![2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one Structure](https://www.chemsrc.com/extcaspic/158/1454588-04-5.png)
2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one structure
|
Common Name | 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 1454588-04-5 | Molecular Weight | 259.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10ClN3O |
|---|---|
| Molecular Weight | 259.69 |
| InChIKey | PNZPIRMSPLSREJ-UHFFFAOYSA-N |
| SMILES | Cn1ccn2nc(-c3ccc(Cl)cc3)cc2c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: CAS number of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is 1454588-04-5. |
| Q: What is the molecular weight of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: Molecular weight of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is 259.69. |
| Q: What is the Chinese name of 1454588-04-5? |
| A: Chinese name of 1454588-04-5 is 1454588-04-5. |
| Q: What is the SMILES notation of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: SMILES notation of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is Cn1ccn2nc(-c3ccc(Cl)cc3)cc2c1=O. |
| Q: What is the English name of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: The English name of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one. |
| Q: What is the molecular formula of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: Molecular formula of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is C13H10ClN3O. |
| Q: What is the InChIKey of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one? |
| A: InChIKey of 2-(4-chlorophenyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5H)-one is PNZPIRMSPLSREJ-UHFFFAOYSA-N. |