2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine structure
|
Common Name | 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 1454657-58-9 | Molecular Weight | 269.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15N3O2 |
|---|---|
| Molecular Weight | 269.30 |
| InChIKey | PTVMHEXQSRZCFS-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1CCc2ccncc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: Molecular weight of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is 269.30. |
| Q: What is the molecular formula of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: Molecular formula of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is C15H15N3O2. |
| Q: What is the SMILES notation of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: SMILES notation of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is Cc1cc([N+](=O)[O-])ccc1N1CCc2ccncc2C1. |
| Q: What is the CAS number of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: CAS number of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is 1454657-58-9. |
| Q: What is the InChIKey of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: InChIKey of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is PTVMHEXQSRZCFS-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine? |
| A: The English name of 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine is 2-(2-Methyl-4-nitrophenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine. |
| Q: What is the Chinese name of 1454657-58-9? |
| A: Chinese name of 1454657-58-9 is 1454657-58-9. |