4-methoxy-N-(pyridin-4-yl)benzamide structure
|
Common Name | 4-methoxy-N-(pyridin-4-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 14547-75-2 | Molecular Weight | 228.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-N-(pyridin-4-yl)benzamide |
|---|
| Molecular Formula | C13H12N2O2 |
|---|---|
| Molecular Weight | 228.25 |
| InChIKey | PJCYIPIOMMKQMC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=NC=C2 |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Inhibition of beta-hematin in water/NP40/DMSO solution incubated for 5 to 6hrs by det...
Source: ChEMBL
Target: Hemozoin
External Id: CHEMBL4428589
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Binding affinity to Fe(3)PP9 solution assessed as ferriprotoporphyrin 9 complex forma...
Source: ChEMBL
Target: Ferriprotoporphyrin IX
External Id: CHEMBL4428622
|