3-(4-Iodophenyl)-1-phenyl-2-propen-1-one structure
|
Common Name | 3-(4-Iodophenyl)-1-phenyl-2-propen-1-one | ||
|---|---|---|---|---|
| CAS Number | 14548-42-6 | Molecular Weight | 334.15200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-iodophenyl)-1-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11IO |
|---|---|
| Molecular Weight | 334.15200 |
| Exact Mass | 333.98500 |
| PSA | 17.07000 |
| LogP | 4.18730 |
| InChIKey | CKOASMDIUOUHGN-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccc(I)cc1)c1ccccc1 |
| HS Code | 2914700090 |
|---|
|
~62%
3-(4-Iodophenyl... CAS#:14548-42-6 |
| Literature: Bellier, Quentin; Pegaz, Sarah; Aronica, Christophe; Guennic, Boris Le; Andraud, Chantal; Maury, Olivier Organic Letters, 2011 , vol. 13, # 1 p. 22 - 25 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Jodchalcon |