(R)(2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER
![(R)(2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER Structure](https://image.chemsrc.com/caspic/094/145485-03-6.png)
(R)(2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER structure
|
Common Name | (R)(2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 145485-03-6 | Molecular Weight | 276.33100 | |
| Density | 1.175g/cm3 | Boiling Point | 472.454ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.532ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 472.454ºC at 760 mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33100 |
| Flash Point | 239.532ºC |
| Exact Mass | 276.14700 |
| PSA | 67.43000 |
| LogP | 2.99350 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | KMQMLZIXVMSMOI-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCc2ccccc2NC1=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![tert-butyl (2-oxo-2,5-dihydro-1H-benzo[b]azepin-3-yl)carbamate structure](https://image.chemsrc.com/caspic/491/156247-60-8.png)
![tert-Butyl (S)-(2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-3-yl)carbamate structure](https://www.chemsrc.com/extcaspic/453/156247-61-9.png)
![3-amino-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one structure](https://image.chemsrc.com/caspic/362/86499-35-6.png)
![4,5-Dihydro-1H-benzo[b]azepin-2(3H)-one structure](https://image.chemsrc.com/caspic/098/4424-80-0.png)
![3-Azido-1,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one structure](https://image.chemsrc.com/caspic/060/97278-68-7.png)
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: Boiling point of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is 472.454ºC at 760 mmHg. |
| Q: What is the CAS number of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: CAS number of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is 145485-03-6. |
| Q: What is the SMILES notation of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: SMILES notation of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is CC(C)(C)OC(=O)NC1CCc2ccccc2NC1=O. |
| Q: What is the polar surface area (PSA) of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is 67.43000. |
| Q: What is the LogP of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: LogP of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is 2.99350. |
| Q: What is the molecular formula of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: Molecular formula of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is C15H20N2O3. |
| Q: What is the molecular weight of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: Molecular weight of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is 276.33100. |
| Q: What is the InChIKey of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: InChIKey of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is KMQMLZIXVMSMOI-GFCCVEGCSA-N. |
| Q: What is the English name of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate? |
| A: The English name of tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate is tert-butyl N-[(3R)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]carbamate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |