3,5,7,10,12,14,17,19,21,24,26,28-dodecamethyl[1.1.1.1!methacyclophane-4,11,18,25-oh, contns. ca 4 mole dmf of cryst. structure
|
Common Name | 3,5,7,10,12,14,17,19,21,24,26,28-dodecamethyl[1.1.1.1!methacyclophane-4,11,18,25-oh, contns. ca 4 mole dmf of cryst. | ||
|---|---|---|---|---|
| CAS Number | 145572-23-2 | Molecular Weight | 592.80700 | |
| Density | N/A | Boiling Point | 310ºC | |
| Molecular Formula | C40H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,7,10,12,14,17,19,21,24,26,28-dodecamethyl[1.1.1.1!methacyclophane-4,11,18,25-oh, contns. ca 4 mole dmf of cryst. |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 310ºC |
|---|---|
| Molecular Formula | C40H48O4 |
| Molecular Weight | 592.80700 |
| Exact Mass | 592.35500 |
| PSA | 80.92000 |
| LogP | 8.88640 |
| InChIKey | WAKLCZAHNJRGDW-UHFFFAOYSA-N |
| SMILES | Cc1c(O)c(C)c2c(C)c1Cc1c(C)c(O)c(C)c(c1C)Cc1c(C)c(O)c(C)c(c1C)Cc1c(C)c(O)c(C)c(c1C)C2 |
| 3,5,7,10,12,14,17,19,21,24,26,28-Dodecamethyl[1.1.1.1]metacyclophane-4,11,18,25 |
| 3,5,7,10,12,14,17,19,21,24,26,28-Dodecamethyl[1.1.1.1]methacyclophane-4,11,18,25-OH |
| 3,5,7,10,12,14,17,19,21,24,26,28-Dodecamethyl[1.1.1.1]methacyclophane-4,11,18,25-OH,contns. ca 4 mole DMF of cryst. |
| 3,5,7,10,12,14,17,19,21,24,26,28-dodecamethyl[1.1.1.1]metacyclophane-4,11,18,25-tetrol |
| 3,5,7,10,12,14,17,19,21,24,26,28-Dodecamethyl[1.1.1.1]methacyclophane-4,11,18,25-OH,contns |