Lcj4RS3nle
Modify Date: 2026-08-03 13:23:43
Lcj4RS3nle structure
|
Common Name | Lcj4RS3nle | ||
|---|---|---|---|---|
| CAS Number | 145679-14-7 | Molecular Weight | 194.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Lcj4RS3nle |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10O4 |
|---|---|
| Molecular Weight | 194.18 |
| InChIKey | ZHJJCJKDNFTHKD-LURJTMIESA-N |
| SMILES | CC(C(=O)O)c1ccc(C(=O)O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 145679-14-7? |
| A: Chinese name of 145679-14-7 is 145679-14-7. |
| Q: What is the English name of Lcj4RS3nle? |
| A: The English name of Lcj4RS3nle is Lcj4RS3nle. |
| Q: What is the molecular formula of Lcj4RS3nle? |
| A: Molecular formula of Lcj4RS3nle is C10H10O4. |
| Q: What is the InChIKey of Lcj4RS3nle? |
| A: InChIKey of Lcj4RS3nle is ZHJJCJKDNFTHKD-LURJTMIESA-N. |
| Q: What is the CAS number of Lcj4RS3nle? |
| A: CAS number of Lcj4RS3nle is 145679-14-7. |
| Q: What is the SMILES notation of Lcj4RS3nle? |
| A: SMILES notation of Lcj4RS3nle is CC(C(=O)O)c1ccc(C(=O)O)cc1. |
| Q: What is the molecular weight of Lcj4RS3nle? |
| A: Molecular weight of Lcj4RS3nle is 194.18. |