3,4-dichloro-N-[(3,4-dichlorophenyl)diazenyl]aniline structure
|
Common Name | 3,4-dichloro-N-[(3,4-dichlorophenyl)diazenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 14581-48-7 | Molecular Weight | 335.01600 | |
| Density | 1.52g/cm3 | Boiling Point | 434.1ºC at 760mmHg | |
| Molecular Formula | C12H7Cl4N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4ºC | |
| Name | 3,4-dichloro-N-[(3,4-dichlorophenyl)diazenyl]aniline |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 434.1ºC at 760mmHg |
| Molecular Formula | C12H7Cl4N3 |
| Molecular Weight | 335.01600 |
| Flash Point | 216.4ºC |
| Exact Mass | 332.93900 |
| PSA | 36.75000 |
| LogP | 6.48400 |
| Vapour Pressure | 9.7E-08mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | DJNJWUBWQLGVRV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(N=NNc2ccc(Cl)c(Cl)c2)cc1Cl |
|
~99%
3,4-dichloro-N-... CAS#:14581-48-7 |
| Literature: Stefane, Bogdan; Kocevar, Marijan; Polanc, Slovenko Journal of Organic Chemistry, 1997 , vol. 62, # 21 p. 7165 - 7169 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |