25(R)-epimer of Po-8
Modify Date: 2025-09-11 19:55:18
25(R)-epimer of Po-8 structure
|
Common Name | 25(R)-epimer of Po-8 | ||
|---|---|---|---|---|
| CAS Number | 145867-19-2 | Molecular Weight | 919.058 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 1043.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H74O19 | Melting Point | 198 - 200 °C | |
| MSDS | N/A | Flash Point | 584.9±34.3 °C | |
| Name | 25(R)-epimer of Po-8 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 1043.5±65.0 °C at 760 mmHg |
| Melting Point | 198 - 200 °C |
| Molecular Formula | C45H74O19 |
| Molecular Weight | 919.058 |
| Flash Point | 584.9±34.3 °C |
| Exact Mass | 918.482422 |
| LogP | -0.14 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | GVXYKYSNVDIKBN-TVRYDQIASA-N |
| SMILES | CC(CCC1(O)OC2CC3C4CC=C5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(O)C7O)C(O)C6O)CCC5(C)C4CCC3(C)C2C1C)COC1OC(CO)C(O)C(O)C1O |
| β-D-Galactopyranoside, (3β,8ξ,9ξ,14ξ,16ξ,17ξ,25R)-26-(β-D-glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl 4-O-β-D-glucopyranosyl- |
| (3β,8ξ,9ξ,14ξ,16ξ,17ξ,25R)-26-(β-D-Glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl 4-O-β-D-glucopyranosyl-β-D-galactopyranoside |