N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide structure
|
Common Name | N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 14593-09-0 | Molecular Weight | 345.43400 | |
| Density | 1.149g/cm3 | Boiling Point | 592.3ºC at 760mmHg | |
| Molecular Formula | C23H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312ºC | |
| Name | N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 592.3ºC at 760mmHg |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.43400 |
| Flash Point | 312ºC |
| Exact Mass | 345.17300 |
| PSA | 52.82000 |
| LogP | 5.03030 |
| Vapour Pressure | 7.07E-15mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | WUHXJEYNCVLJDM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Acetamido-1,1,3-triphenyl-1-propanol |
| 3-Acetylamino-1,1,3-triphenyl-propan-1-ol |
| 1,1,3-Triphenyl-3-acetamido-1-propanol |
| LS-9773 |