Ethanaminium,N,N,N-trimethyl-2-phosphono-, inner salt structure
|
Common Name | Ethanaminium,N,N,N-trimethyl-2-phosphono-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 14596-57-7 | Molecular Weight | 167.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H14NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(2-phosphonatoethyl)azanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H14NO3P |
|---|---|
| Molecular Weight | 167.14300 |
| Exact Mass | 167.07100 |
| PSA | 70.17000 |
| LogP | 0.30850 |
| InChIKey | VCANKBLUHKRQLL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCP(=O)([O-])O |
|
~%
Ethanaminium,N,... CAS#:14596-57-7 |
| Literature: Myers; Jibril Journal of Organic Chemistry, 1957 , vol. 22, p. 180 Full Text View citing articles Show Details Rosenthal; Geyer Journal of the American Chemical Society, 1958 , vol. 80, p. 5240 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| trimethyl-(2-phosphono-ethyl)-ammonium betaine |
| Ethanaminium,N,N,N-trimethyl-2-phosphono-,hydroxide,inner salt |
| [2-(trimethylammonio)ethyl]phosphonate |
| (2-Trimethylammonio-aethyl)-phosphonsaeure-betain |
| N,N,N-Trimethyl-2-aminoethylphosphonate |
| Ammonium,trimethyl(2-phosphonoethyl)-,hydroxide,inner salt |
| Phosphonylcholin |
| TMAEP |
| Trimethyl-(2-phosphono-aethyl)-ammonium-betain |
| OPhosphono-cholin-betain |