(8alpha,9R)-6'-methoxycinchonan-9-ol, compound with 2,3-dihydroxypropyl (dihydrogen phosphate) (2:1) structure
|
Common Name | (8alpha,9R)-6'-methoxycinchonan-9-ol, compound with 2,3-dihydroxypropyl (dihydrogen phosphate) (2:1) | ||
|---|---|---|---|---|
| CAS Number | 146-39-4 | Molecular Weight | 478.47500 | |
| Density | N/A | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C23H31N2O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | 2,3-dihydroxypropyl [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 495.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H31N2O7P |
| Molecular Weight | 478.47500 |
| Flash Point | 253.7ºC |
| Exact Mass | 478.18700 |
| PSA | 131.39000 |
| LogP | 2.60560 |
| Vapour Pressure | 1.19E-10mmHg at 25°C |
| InChIKey | YZDDKALBXAGVHK-MDSABZTASA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.O=P(O)(O)OCC(O)CO |
| EINECS 205-669-4 |