Tert-butyl 2-fluoro-6-iodobenzoate
Modify Date: 2025-11-04 11:17:13
Tert-butyl 2-fluoro-6-iodobenzoate structure
|
Common Name | Tert-butyl 2-fluoro-6-iodobenzoate | ||
|---|---|---|---|---|
| CAS Number | 146014-71-3 | Molecular Weight | 322.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FIO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-fluoro-6-iodobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12FIO2 |
|---|---|
| Molecular Weight | 322.11 |
| InChIKey | WAWODSZRJQRWBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1c(F)cccc1I |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: CAS number of Tert-butyl 2-fluoro-6-iodobenzoate is 146014-71-3. |
| Q: What is the English name of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: The English name of Tert-butyl 2-fluoro-6-iodobenzoate is Tert-butyl 2-fluoro-6-iodobenzoate. |
| Q: What is the InChIKey of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: InChIKey of Tert-butyl 2-fluoro-6-iodobenzoate is WAWODSZRJQRWBH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: Molecular weight of Tert-butyl 2-fluoro-6-iodobenzoate is 322.11. |
| Q: What is the SMILES notation of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: SMILES notation of Tert-butyl 2-fluoro-6-iodobenzoate is CC(C)(C)OC(=O)c1c(F)cccc1I. |
| Q: What is the molecular formula of Tert-butyl 2-fluoro-6-iodobenzoate? |
| A: Molecular formula of Tert-butyl 2-fluoro-6-iodobenzoate is C11H12FIO2. |
| Q: What is the Chinese name of 146014-71-3? |
| A: Chinese name of 146014-71-3 is 146014-71-3. |