Bis(tribromomethyl) sulfoxide structure
|
Common Name | Bis(tribromomethyl) sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 14604-61-6 | Molecular Weight | 551.51000 | |
| Density | 3.67g/cm3 | Boiling Point | 390.7ºC at 760mmHg | |
| Molecular Formula | C2Br6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | tribromo(tribromomethylsulfinyl)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 3.67g/cm3 |
|---|---|
| Boiling Point | 390.7ºC at 760mmHg |
| Molecular Formula | C2Br6OS |
| Molecular Weight | 551.51000 |
| Flash Point | 190.1ºC |
| Exact Mass | 545.47700 |
| PSA | 36.28000 |
| LogP | 5.19280 |
| Vapour Pressure | 5.86E-06mmHg at 25°C |
| Index of Refraction | 1.839 |
| InChIKey | IMXXWWGWTMVZBZ-UHFFFAOYSA-N |
| SMILES | O=S(C(Br)(Br)Br)C(Br)(Br)Br |
| HS Code | 2930909090 |
|---|
|
~%
Bis(tribromomet... CAS#:14604-61-6 |
| Literature: Farrar Journal of the Chemical Society, 1956 , p. 508,510 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bis-tribrommethyl-sulfoxid |
| Hexabromodimethyl sulfoxide |
| Methanesulfoxide,bistribromo |
| Bis-tribromomethyl sulphoxide |
| Sulfoxide,bis(tribromomethyl) |
| bis(tribromomethyl) sulfoxide |
| Methane,sulfinylbis(tribromo |