1-Benzenesulfonyl-7-methoxy-1H-indole structure
|
Common Name | 1-Benzenesulfonyl-7-methoxy-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 146073-32-7 | Molecular Weight | 287.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonyl)-7-methoxyindole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13NO3S |
|---|---|
| Molecular Weight | 287.33400 |
| Exact Mass | 287.06200 |
| PSA | 56.68000 |
| LogP | 3.96770 |
| InChIKey | JPLYCGNNGYBEQO-UHFFFAOYSA-N |
| SMILES | COc1cccc2ccn(S(=O)(=O)c3ccccc3)c12 |
|
~84%
1-Benzenesulfon... CAS#:146073-32-7 |
| Literature: Gourdoupis; Stamos Synthetic Communications, 1994 , vol. 24, # 8 p. 1137 - 1144 |
|
~%
1-Benzenesulfon... CAS#:146073-32-7 |
| Literature: SYNTA PHARMACEUTICALS CORP. Patent: WO2008/21364 A2, 2008 ; Location in patent: Page/Page column 139 ; |
|
~69%
1-Benzenesulfon... CAS#:146073-32-7 |
| Literature: Fuji; Muratake; Natsume Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 9 p. 2344 - 2352 |
|
~%
1-Benzenesulfon... CAS#:146073-32-7 |
| Literature: Fuji; Muratake; Natsume Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 9 p. 2344 - 2352 |
|
~%
1-Benzenesulfon... CAS#:146073-32-7 |
| Literature: Fuji; Muratake; Natsume Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 9 p. 2344 - 2352 |
| 7-methoxy-1-phenylsulfonyl-1H-indole |
| 1-BENZENESULFONYL-7-METHOXY-1H-INDOLE |
| N-benzenesulphonyl-7-methoxyindole |
| 1-benzenesulfonyl-7-methoxyindole |
| 7-methoxy-N-benzenesulfonylindole |