benzenesulphonic acid, compound with triethylamine (1:1) structure
|
Common Name | benzenesulphonic acid, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 14613-32-2 | Molecular Weight | 259.36500 | |
| Density | N/A | Boiling Point | 387ºC at 760 mmHg | |
| Molecular Formula | C12H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | benzenesulfonic acid,N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 387ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.36500 |
| Flash Point | 187.8ºC |
| Exact Mass | 259.12400 |
| PSA | 65.99000 |
| LogP | 3.36220 |
| Vapour Pressure | 1.11E-06mmHg at 25°C |
| InChIKey | OPJDPIWCAQORQI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.O=S(=O)(O)c1ccccc1 |
| Benzolsulfonsaeure,Salz des Triaethylamins |
| EINECS 238-652-5 |
| benzenesulfonic acid,compound with triethylamine |
| Benzolsulfonsaeure,Verbindung mit Triaethylamin |