3H-1,2-Benzoxathiole,5-nitro-, 2,2-dioxide structure
|
Common Name | 3H-1,2-Benzoxathiole,5-nitro-, 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 14618-10-1 | Molecular Weight | 215.18300 | |
| Density | 1.681g/cm3 | Boiling Point | 432.3ºC at 760mmHg | |
| Molecular Formula | C7H5NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 5-nitro-3H-1,2λ6-benzoxathiole 2,2-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.681g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760mmHg |
| Molecular Formula | C7H5NO5S |
| Molecular Weight | 215.18300 |
| Flash Point | 215.2ºC |
| Exact Mass | 214.98900 |
| PSA | 97.57000 |
| LogP | 2.42100 |
| Vapour Pressure | 2.84E-07mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | NKGKZWZGRMZCMO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CS(=O)(=O)O2 |
| HS Code | 2934991000 |
|---|
|
~79%
3H-1,2-Benzoxat... CAS#:14618-10-1 |
| Literature: Wojciechowski, Krzysztof; Dolatowska, Karolina Tetrahedron, 2005 , vol. 61, # 35 p. 8419 - 8422 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934991000 |
|---|---|
| Summary | 2934991000. sultones and sultams. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-3H-1,2-benzoxathiole 2,2-dioxide |
| 3H-1,2-Benzoxathiole,5-nitro-,2,2-dioxide |
| 5-nitro-3H-1,2 |
| 5-nitro-3H-benzo[d][1,2]oxathiol-2,2-dioxide |
| 5-nitro-3H-1,2-benzoxathiole S,S-dioxide |
| 5-Nitrobenz<1,6-d>-3H-1,2-oxathiole S,S-dioxide |
| 4-Hydroxy-5-nitrophenylmethanesulfonic acid sultone |
| 2-Hydroxy-5-nitrophenylmethanesulfonic acid sultone |