Benzenepropanamide, a-(acetylamino)-N,N-bis(2-chloroethyl)- structure
|
Common Name | Benzenepropanamide, a-(acetylamino)-N,N-bis(2-chloroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1462-82-4 | Molecular Weight | 331.23800 | |
| Density | 1.221g/cm3 | Boiling Point | 549ºC at 760mmHg | |
| Molecular Formula | C15H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.8ºC | |
| Name | 2-acetamido-N,N-bis(2-chloroethyl)-3-phenylpropanamide |
|---|
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 549ºC at 760mmHg |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.23800 |
| Flash Point | 285.8ºC |
| Exact Mass | 330.09000 |
| PSA | 49.41000 |
| LogP | 2.43090 |
| Vapour Pressure | 4.21E-12mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | JNJQLUMWCMUHAO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)N(CCCl)CCCl |
| HS Code | 2924299090 |
|---|
|
~%
Benzenepropanam... CAS#:1462-82-4 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |