2-Oxazolidinethione,3-(phenylsulfonyl)- structure
|
Common Name | 2-Oxazolidinethione,3-(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 14627-86-2 | Molecular Weight | 243.30300 | |
| Density | 1.53g/cm3 | Boiling Point | 364.6ºC at 760mmHg | |
| Molecular Formula | C9H9NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 3-(benzenesulfonyl)-1,3-oxazolidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760mmHg |
| Molecular Formula | C9H9NO3S2 |
| Molecular Weight | 243.30300 |
| Flash Point | 174.3ºC |
| Exact Mass | 243.00200 |
| PSA | 87.08000 |
| LogP | 2.01110 |
| Vapour Pressure | 1.67E-05mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | WMCABOCQNFKXIP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)N1CCOC1=S |
|
~%
2-Oxazolidineth... CAS#:14627-86-2 |
| Literature: McFarland,J.W.; Houser,R.W. Journal of Organic Chemistry, 1968 , vol. 33, p. 340 - 343 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Benzolsulfonyl-2-thioxo-oxazolidin |
| 3-benzenesulfonyl-oxazolidine-2-thione |