2-methoxy-5-nitro-2,4,6-cycloheptatrien-1-one structure
|
Common Name | 2-methoxy-5-nitro-2,4,6-cycloheptatrien-1-one | ||
|---|---|---|---|---|
| CAS Number | 14628-90-1 | Molecular Weight | 181.14500 | |
| Density | 1.31g/cm3 | Boiling Point | 313.1ºC at 760mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | 2-methoxy-5-nitrocyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 313.1ºC at 760mmHg |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.14500 |
| Flash Point | 156.4ºC |
| Exact Mass | 181.03800 |
| PSA | 72.12000 |
| LogP | 1.48680 |
| Vapour Pressure | 0.000506mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | SRVBIVSFLVFSAB-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])ccc1=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-methoxy-5-nitro-cycloheptatrien-1-one |
| 2-Methoxy-5-nitro-tropon |
| 5-Nitro-tropolon-methylether |
| 2-Methoxy-5-nitro-2,4,6-cycloheptatrien-1-one |
| 2-methoxy-5-nitrotropone |
| EINECS 238-670-3 |
| 2-Methoxy-5-nitro-cycloheptatrienon |
| 2-methoxy-5-nitro-cycloheptatrienone |