ethyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate structure
|
Common Name | ethyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate | ||
|---|---|---|---|---|
| CAS Number | 1463-52-1 | Molecular Weight | 284.35300 | |
| Density | 1.148g/cm3 | Boiling Point | 430.4ºC at 760mmHg | |
| Molecular Formula | C17H20N2O2 | Melting Point | 64-67ºC | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | ethyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 430.4ºC at 760mmHg |
| Melting Point | 64-67ºC |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.35300 |
| Flash Point | 214.1ºC |
| Exact Mass | 284.15200 |
| PSA | 53.33000 |
| LogP | 2.60358 |
| Vapour Pressure | 1.31E-07mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | HSTSIRUENGPGSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=C1CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~99%
ethyl 2-(1-benz... CAS#:1463-52-1 |
| Literature: NOVARTIS AG; NOVARTIS PHARMA GMBH Patent: WO2004/69256 A1, 2004 ; Location in patent: Page/Page column 41 ; WO 2004/069256 A1 |
|
~85%
ethyl 2-(1-benz... CAS#:1463-52-1 |
| Literature: Asadipour, Ali; Alipour, Masoumeh; Jafari, Mona; Khoobi, Mehdi; Emami, Saeed; Nadri, Hamid; Sakhteman, Amirhossein; Moradi, Alireza; Sheibani, Vahid; Homayouni Moghadam, Farshad; Shafiee, Abbas; Foroumadi, Alireza European Journal of Medicinal Chemistry, 2013 , vol. 70, p. 623 - 630 |
|
~%
ethyl 2-(1-benz... CAS#:1463-52-1 |
| Literature: European Journal of Medicinal Chemistry, , vol. 70, p. 623 - 630 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1-Benzyl-[4]piperidyliden)-cyan-essigsaeure-aethylester |
| (1-benzylpiperidin-4-ylidine)cyanoacetic acid ethyl ester |
| ethyl 2-cyano-2-[1-(phenylmethyl)-4-piperidinylidene]acetate |
| (1-benzyl-piperidin-4-ylidene)-cyano-acetic acid ethyl ester |
| ethyl (1-benzyl-4-piperidylidene)cyanoacetate |
| ethyl 2-(1-benzyl-4-piperidinylidene)-2-cyanoacetate |