Benzene,1-[(4-chlorobutyl)sulfonyl]-4-methyl- structure
|
Common Name | Benzene,1-[(4-chlorobutyl)sulfonyl]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 14633-42-2 | Molecular Weight | 246.75400 | |
| Density | 1.184g/cm3 | Boiling Point | 400.4ºC at 760mmHg | |
| Molecular Formula | C11H15ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.9ºC | |
| Name | 1-(4-chlorobutylsulfonyl)-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 400.4ºC at 760mmHg |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.75400 |
| Flash Point | 195.9ºC |
| Exact Mass | 246.04800 |
| PSA | 42.52000 |
| LogP | 3.86850 |
| Vapour Pressure | 2.95E-06mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | FGWSYQDVJCSREF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCl)cc1 |
|
~%
Benzene,1-[(4-c... CAS#:14633-42-2 |
| Literature: Shinriki,N.; Nambara,T. Chemical and Pharmaceutical Bulletin, 1963 , vol. 11, p. 178 - 183 |
|
~%
Benzene,1-[(4-c... CAS#:14633-42-2 |
| Literature: Truce,W.E. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 1 p. 43 - 47 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| p-Tolyloxybutylchloride |
| 1-Chlor-4-<p-tolylsulfonyl>-butan |
| 4-Chlorobutyl-p-tolylether |