2,3-Pyrrolidinedione,4-[(4-hydroxy-3-methoxyphenyl)methylene]-1-methyl- structure
|
Common Name | 2,3-Pyrrolidinedione,4-[(4-hydroxy-3-methoxyphenyl)methylene]-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 14646-15-2 | Molecular Weight | 247.24700 | |
| Density | 1.351g/cm3 | Boiling Point | 419.5ºC at 760mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 4-[(4-hydroxy-3-methoxyphenyl)methylidene]-1-methylpyrrolidine-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 207.5ºC |
| Exact Mass | 247.08400 |
| PSA | 66.84000 |
| LogP | 0.76320 |
| Vapour Pressure | 1.24E-07mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | IRSSPCVUYLQFJE-WEVVVXLNSA-N |
| SMILES | COc1cc(C=C2CN(C)C(=O)C2=O)ccc1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Pyrrolidinedione,1-methyl-4-vanilliylidene-(8CI) |
| 4-(4-hydroxy-3-methoxy-benzylidene)-1-methyl-pyrrolidine-2,3-dione |
| 1-Methyl-4-vanillyliden-pyrrolidin-2,3-dion |
| 2,3-Pyrrolidinedione,1-methyl-4-vanilliylidene |
| 2,3-Pyrrolidinedione,4-[(4-hydroxy-3-methoxyphenyl)methylene]-1-methyl |