4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol
Modify Date: 2026-09-27 23:17:57
![4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol Structure](https://www.chemsrc.com/extcaspic/133/1464897-20-8.png)
4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol structure
|
Common Name | 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol | ||
|---|---|---|---|---|
| CAS Number | 1464897-20-8 | Molecular Weight | 239.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18FNO2 |
|---|---|
| Molecular Weight | 239.29 |
| InChIKey | BDKKOKHMWLYKFP-UHFFFAOYSA-N |
| SMILES | OC1(CNCc2ccc(F)cc2)CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: Molecular formula of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is C13H18FNO2. |
| Q: What is the CAS number of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: CAS number of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is 1464897-20-8. |
| Q: What is the InChIKey of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: InChIKey of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is BDKKOKHMWLYKFP-UHFFFAOYSA-N. |
| Q: What is the English name of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: The English name of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol. |
| Q: What is the SMILES notation of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: SMILES notation of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is OC1(CNCc2ccc(F)cc2)CCOCC1. |
| Q: What is the molecular weight of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol? |
| A: Molecular weight of 4-({[(4-Fluorophenyl)methyl]amino}methyl)oxan-4-ol is 239.29. |
| Q: What is the Chinese name of 1464897-20-8? |
| A: Chinese name of 1464897-20-8 is 1464897-20-8. |