Unii-S8F1ybt7RG
Modify Date: 2025-10-16 09:25:52
Unii-S8F1ybt7RG structure
|
Common Name | Unii-S8F1ybt7RG | ||
|---|---|---|---|---|
| CAS Number | 1465-20-9 | Molecular Weight | 352.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Unii-S8F1ybt7RG |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H28N2O2 |
|---|---|
| Molecular Weight | 352.5 |
| InChIKey | BPXVEPWHWMDYCP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Unii-S8F1ybt7RG? |
| A: SMILES notation of Unii-S8F1ybt7RG is CCOC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1. |
| Q: What is the Chinese name of 1465-20-9? |
| A: Chinese name of 1465-20-9 is 1465-20-9. |
| Q: What is the CAS number of Unii-S8F1ybt7RG? |
| A: CAS number of Unii-S8F1ybt7RG is 1465-20-9. |
| Q: What is the InChIKey of Unii-S8F1ybt7RG? |
| A: InChIKey of Unii-S8F1ybt7RG is BPXVEPWHWMDYCP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Unii-S8F1ybt7RG? |
| A: Molecular weight of Unii-S8F1ybt7RG is 352.5. |
| Q: What is the molecular formula of Unii-S8F1ybt7RG? |
| A: Molecular formula of Unii-S8F1ybt7RG is C22H28N2O2. |
| Q: What is the English name of Unii-S8F1ybt7RG? |
| A: The English name of Unii-S8F1ybt7RG is Unii-S8F1ybt7RG. |