1-[diazo-(3-nitrophenyl)methyl]-3-nitrobenzene structure
|
Common Name | 1-[diazo-(3-nitrophenyl)methyl]-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1465-51-6 | Molecular Weight | 284.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[diazo-(3-nitrophenyl)methyl]-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8N4O4 |
|---|---|
| Molecular Weight | 284.22700 |
| Exact Mass | 284.05500 |
| PSA | 129.03000 |
| LogP | 3.69766 |
| InChIKey | FVZLLACXHRQMTG-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=C(c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
|
~%
1-[diazo-(3-nit... CAS#:1465-51-6 |
| Literature: Bethell, Donald; Bourne, Raymond; Kasran, Madzlan Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 10 p. 2081 - 2084 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3'-dinitrodiphenyldiazomethane |
| 3,3'-Dinitro-diphenyl-diazomethan |