FLsharptrade mark-Phosphate, disodium salt
Modify Date: 2025-09-23 16:35:38
FLsharptrade mark-Phosphate, disodium salt structure
|
Common Name | FLsharptrade mark-Phosphate, disodium salt | ||
|---|---|---|---|---|
| CAS Number | 146508-65-8 | Molecular Weight | 431.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H7Cl2N2Na2O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | FLsharptrade mark-Phosphate, disodium salt |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H7Cl2N2Na2O5P |
|---|---|
| Molecular Weight | 431.1 |
| InChIKey | OBYXHRHRSPWVJK-UHFFFAOYSA-L |
| SMILES | O=c1[nH]c(-c2cc(Cl)ccc2OP(=O)([O-])[O-])nc2ccc(Cl)cc12.[Na+].[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of FLsharptrade mark-Phosphate, disodium salt? |
| A: Molecular weight of FLsharptrade mark-Phosphate, disodium salt is 431.1. |
| Q: What is the English name of FLsharptrade mark-Phosphate, disodium salt? |
| A: The English name of FLsharptrade mark-Phosphate, disodium salt is FLsharptrade mark-Phosphate, disodium salt. |
| Q: What is the InChIKey of FLsharptrade mark-Phosphate, disodium salt? |
| A: InChIKey of FLsharptrade mark-Phosphate, disodium salt is OBYXHRHRSPWVJK-UHFFFAOYSA-L. |
| Q: What is the CAS number of FLsharptrade mark-Phosphate, disodium salt? |
| A: CAS number of FLsharptrade mark-Phosphate, disodium salt is 146508-65-8. |
| Q: What is the molecular formula of FLsharptrade mark-Phosphate, disodium salt? |
| A: Molecular formula of FLsharptrade mark-Phosphate, disodium salt is C14H7Cl2N2Na2O5P. |
| Q: What is the Chinese name of 146508-65-8? |
| A: Chinese name of 146508-65-8 is 146508-65-8. |
| Q: What is the SMILES notation of FLsharptrade mark-Phosphate, disodium salt? |
| A: SMILES notation of FLsharptrade mark-Phosphate, disodium salt is O=c1[nH]c(-c2cc(Cl)ccc2OP(=O)([O-])[O-])nc2ccc(Cl)cc12.[Na+].[Na+]. |