N-(1-cyanopropyl)-2,6-dimethyl-benzamide
Modify Date: 2025-09-22 11:19:18
N-(1-cyanopropyl)-2,6-dimethyl-benzamide structure
|
Common Name | N-(1-cyanopropyl)-2,6-dimethyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 1465341-30-3 | Molecular Weight | 216.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1-cyanopropyl)-2,6-dimethyl-benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O |
|---|---|
| Molecular Weight | 216.28 |
| InChIKey | ZZZPRSHJLJPGGV-UHFFFAOYSA-N |
| SMILES | CCC(C#N)NC(=O)c1c(C)cccc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: Molecular weight of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is 216.28. |
| Q: What is the SMILES notation of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: SMILES notation of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is CCC(C#N)NC(=O)c1c(C)cccc1C. |
| Q: What is the InChIKey of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: InChIKey of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is ZZZPRSHJLJPGGV-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: CAS number of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is 1465341-30-3. |
| Q: What is the molecular formula of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: Molecular formula of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is C13H16N2O. |
| Q: What is the English name of N-(1-cyanopropyl)-2,6-dimethyl-benzamide? |
| A: The English name of N-(1-cyanopropyl)-2,6-dimethyl-benzamide is N-(1-cyanopropyl)-2,6-dimethyl-benzamide. |
| Q: What is the Chinese name of 1465341-30-3? |
| A: Chinese name of 1465341-30-3 is 1465341-30-3. |